About 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane
2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (PubChem CID 87238354) has the molecular formula C16H34O6
and a molecular weight of 322.44 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
Molecular Properties
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| PubChem CID | 87238354 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane |
| SMILES | CC(=O)OCCOCCOCCO.CC(C)(C)OC(C)(C)C |
| InChI | InChI=1S/C8H16O5.C8H18O/c1-8(10)13-7-6-12-5-4-11-3-2-9;1-7(2,3)9-8(4,5)6/h9H,2-7H2,1H3;1-6H3 |
| InChIKey | VELHFVULISZBHD-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The IUPAC name of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane (CID 87238354) is 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane.
What is the SMILES notation for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The canonical SMILES for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is CC(=O)OCCOCCOCCO.CC(C)(C)OC(C)(C)C.
What is the InChIKey of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
The InChIKey is VELHFVULISZBHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O5.C8H18O/c1-8(10)13-7-6-12-5-4-11-3-2-9;1-7(2,3)9-8(4,5)6/h9H,2-7H2,1H3;1-6H3.
What are the key properties of 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane?
2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane has a molecular weight of 322.44 g/mol, XLogP of 2.17, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-hydroxyethoxy)ethoxy]ethyl acetate;2-methyl-2-[(2-methylpropan-2-yl)oxy]propane is sourced from PubChem (CID 87238354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).