C14H26O10 — CID 174537242
bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] oxalate (PubChem CID 174537242) has the molecular formula C14H26O10 and a molecular weight of 354.35 g/mol. Its IUPAC name is bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] oxalate.
| Compound Name | bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] oxalate |
|---|---|
| PubChem CID | 174537242 |
| Molecular Formula | C14H26O10 |
| Molecular Weight | 354.35 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | bis[2-[2-(2-hydroxyethoxy)ethoxy]ethyl] oxalate |
| SMILES | O=C(OCCOCCOCCO)C(=O)OCCOCCOCCO |
| InChI | InChI=1S/C14H26O10/c15-1-3-19-5-7-21-9-11-23-13(17)14(18)24-12-10-22-8-6-20-4-2-16/h15-16H,1-12H2 |
| InChIKey | MTHOLPJPHXLTIG-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 129.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.35 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|