C8H14O4S2 — CID 87240269
2-(2-hydroxyethoxy)ethyl 2-methyl-3,3-bis(sulfanyl)prop-2-enoate (PubChem CID 87240269) has the molecular formula C8H14O4S2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-methyl-3,3-bis(sulfanyl)prop-2-enoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-methyl-3,3-bis(sulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 87240269 |
| Molecular Formula | C8H14O4S2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-methyl-3,3-bis(sulfanyl)prop-2-enoate |
| SMILES | CC(C(=O)OCCOCCO)=C(S)S |
| InChI | InChI=1S/C8H14O4S2/c1-6(8(13)14)7(10)12-5-4-11-3-2-9/h9,13-14H,2-5H2,1H3 |
| InChIKey | ZFTRSSDQULXCMI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|