C22H42O12 — CID 175188156
2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methoxyprop-2-enoate (PubChem CID 175188156) has the molecular formula C22H42O12 and a molecular weight of 498.57 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methoxyprop-2-enoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methoxyprop-2-enoate |
|---|---|
| PubChem CID | 175188156 |
| Molecular Formula | C22H42O12 |
| Molecular Weight | 498.57 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-methoxyprop-2-enoate |
| SMILES | C=C(OC)C(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C22H42O12/c1-21(25-2)22(24)34-20-19-33-18-17-32-16-15-31-14-13-30-12-11-29-10-9-28-8-7-27-6-5-26-4-3-23/h23H,1,3-20H2,2H3 |
| InChIKey | BRFYYMWPSYSCPN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 129.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.57 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|