C8H13NO5 — CID 118963165
2-(2-hydroxyethoxy)ethyl 2-carbamoylprop-2-enoate (PubChem CID 118963165) has the molecular formula C8H13NO5 and a molecular weight of 203.19 g/mol. Its IUPAC name is 2-(2-hydroxyethoxy)ethyl 2-carbamoylprop-2-enoate.
| Compound Name | 2-(2-hydroxyethoxy)ethyl 2-carbamoylprop-2-enoate |
|---|---|
| PubChem CID | 118963165 |
| Molecular Formula | C8H13NO5 |
| Molecular Weight | 203.19 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 2-(2-hydroxyethoxy)ethyl 2-carbamoylprop-2-enoate |
| SMILES | C=C(C(N)=O)C(=O)OCCOCCO |
| InChI | InChI=1S/C8H13NO5/c1-6(7(9)11)8(12)14-5-4-13-3-2-10/h10H,1-5H2,(H2,9,11) |
| InChIKey | ORAHGNQUMRQJAL-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.19 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|