About bis(2-butoxyethyl) 2-methylidenepropanedioate
bis(2-butoxyethyl) 2-methylidenepropanedioate (PubChem CID 156690471) has the molecular formula C16H28O6
and a molecular weight of 316.39 g/mol. Its IUPAC name is bis(2-butoxyethyl) 2-methylidenepropanedioate.
Molecular Properties
| Compound Name | bis(2-butoxyethyl) 2-methylidenepropanedioate |
| PubChem CID | 156690471 |
| Molecular Formula | C16H28O6 |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | bis(2-butoxyethyl) 2-methylidenepropanedioate |
| SMILES | C=C(C(=O)OCCOCCCC)C(=O)OCCOCCCC |
| InChI | InChI=1S/C16H28O6/c1-4-6-8-19-10-12-21-15(17)14(3)16(18)22-13-11-20-9-7-5-2/h3-13H2,1-2H3 |
| InChIKey | VVSDGUXNTPXEJB-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze bis(2-butoxyethyl) 2-methylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-butoxyethyl) 2-methylidenepropanedioate?
The IUPAC name of bis(2-butoxyethyl) 2-methylidenepropanedioate (CID 156690471) is bis(2-butoxyethyl) 2-methylidenepropanedioate.
What is the SMILES notation for bis(2-butoxyethyl) 2-methylidenepropanedioate?
The canonical SMILES for bis(2-butoxyethyl) 2-methylidenepropanedioate is C=C(C(=O)OCCOCCCC)C(=O)OCCOCCCC.
What is the InChIKey of bis(2-butoxyethyl) 2-methylidenepropanedioate?
The InChIKey is VVSDGUXNTPXEJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O6/c1-4-6-8-19-10-12-21-15(17)14(3)16(18)22-13-11-20-9-7-5-2/h3-13H2,1-2H3.
What are the key properties of bis(2-butoxyethyl) 2-methylidenepropanedioate?
bis(2-butoxyethyl) 2-methylidenepropanedioate has a molecular weight of 316.39 g/mol, XLogP of 2.26, 14 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-butoxyethyl) 2-methylidenepropanedioate is sourced from PubChem (CID 156690471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).