C23H46O4Si — CID 140661842
2-[2-(3-tributylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 140661842) has the molecular formula C23H46O4Si and a molecular weight of 414.70 g/mol. Its IUPAC name is 2-[2-(3-tributylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-tributylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140661842 |
| Molecular Formula | C23H46O4Si |
| Molecular Weight | 414.70 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 2-[2-(3-tributylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCC[Si](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C23H46O4Si/c1-6-9-18-28(19-10-7-2,20-11-8-3)21-12-13-25-14-15-26-16-17-27-23(24)22(4)5/h4,6-21H2,1-3,5H3 |
| InChIKey | VVVAVKKJIPTVHK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.70 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|