C24H58O7Si5 — CID 159570466
2-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate;methane (PubChem CID 159570466) has the molecular formula C24H58O7Si5 and a molecular weight of 599.15 g/mol. Its IUPAC name is 2-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate;methane.
| Compound Name | 2-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate;methane |
|---|---|
| PubChem CID | 159570466 |
| Molecular Formula | C24H58O7Si5 |
| Molecular Weight | 599.15 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 2-[3-[[[[[butyl(dimethyl)silyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate;methane |
| SMILES | C.C=C(C)C(=O)OCCOCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCC |
| InChI | InChI=1S/C23H54O7Si5.CH4/c1-14-15-20-31(4,5)27-33(8,9)29-35(12,13)30-34(10,11)28-32(6,7)21-16-17-25-18-19-26-23(24)22(2)3;/h2,14-21H2,1,3-13H3;1H4 |
| InChIKey | MHTBAYICHAYEES-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.15 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|