C29H68O9Si6 — CID 90145211
2-[3-[[[[3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate (PubChem CID 90145211) has the molecular formula C29H68O9Si6 and a molecular weight of 729.37 g/mol. Its IUPAC name is 2-[3-[[[[3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[[[[3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90145211 |
| Molecular Formula | C29H68O9Si6 |
| Molecular Weight | 729.37 g/mol |
| Exact Mass | 728.35 |
| IUPAC Name | 2-[3-[[[[3-[2,3-bis(trimethylsilyloxy)propoxy]propyl-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]oxy-dimethylsilyl]propoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCC[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)CCCOCC(CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C29H68O9Si6/c1-27(2)29(30)33-22-21-31-19-17-23-41(9,10)36-43(13,14)38-44(15,16)37-42(11,12)24-18-20-32-25-28(35-40(6,7)8)26-34-39(3,4)5/h28H,1,17-26H2,2-16H3 |
| InChIKey | DFPJRZFDTNWAIK-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.37 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|