C23H50O7Si3 — CID 158648892
3-[[4-methoxybutyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 158648892) has the molecular formula C23H50O7Si3 and a molecular weight of 522.90 g/mol. Its IUPAC name is 3-[[4-methoxybutyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[4-methoxybutyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158648892 |
| Molecular Formula | C23H50O7Si3 |
| Molecular Weight | 522.90 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 3-[[4-methoxybutyl-[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si](C)(CCCCOC)O[Si](C)(C)CCCOCCOC |
| InChI | InChI=1S/C23H50O7Si3/c1-22(2)23(24)28-16-13-20-32(7,8)30-33(9,21-11-10-14-25-3)29-31(5,6)19-12-15-27-18-17-26-4/h1,10-21H2,2-9H3 |
| InChIKey | YBNQZWKDXMXYHS-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.90 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|