C25H52NO7Si3+ — CID 58901099
2-[3-[bis[[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]silyl]oxy]-methylsilyl]propoxy]ethyl-trimethylazanium (PubChem CID 58901099) has the molecular formula C25H52NO7Si3+ and a molecular weight of 562.95 g/mol. Its IUPAC name is 2-[3-[bis[[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]silyl]oxy]-methylsilyl]propoxy]ethyl-trimethylazanium.
| Compound Name | 2-[3-[bis[[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]silyl]oxy]-methylsilyl]propoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 58901099 |
| Molecular Formula | C25H52NO7Si3+ |
| Molecular Weight | 562.95 g/mol |
| Exact Mass | 562.30 |
| IUPAC Name | 2-[3-[bis[[dimethyl-[2-(2-methylprop-2-enoyloxy)ethyl]silyl]oxy]-methylsilyl]propoxy]ethyl-trimethylazanium |
| SMILES | C=C(C)C(=O)OCC[Si](C)(C)O[Si](C)(CCCOCC[N+](C)(C)C)O[Si](C)(C)CCOC(=O)C(=C)C |
| InChI | InChI=1S/C25H52NO7Si3/c1-22(2)24(27)30-17-20-34(8,9)32-36(12,19-13-15-29-16-14-26(5,6)7)33-35(10,11)21-18-31-25(28)23(3)4/h1,3,13-21H2,2,4-12H3/q+1 |
| InChIKey | UXMINMATSFWRDT-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.95 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|