C24H50O8Si3 — CID 160893632
formaldehyde;3-[[[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methyl-(5-oxopentyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 160893632) has the molecular formula C24H50O8Si3 and a molecular weight of 550.91 g/mol. Its IUPAC name is formaldehyde;3-[[[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methyl-(5-oxopentyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | formaldehyde;3-[[[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methyl-(5-oxopentyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 160893632 |
| Molecular Formula | C24H50O8Si3 |
| Molecular Weight | 550.91 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | formaldehyde;3-[[[3-(2-methoxyethoxy)propyl-dimethylsilyl]oxy-methyl-(5-oxopentyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si](C)(CCCCC=O)O[Si](C)(C)CCCOCCOC.C=O |
| InChI | InChI=1S/C23H48O7Si3.CH2O/c1-22(2)23(25)28-16-13-20-32(6,7)30-33(8,21-11-9-10-14-24)29-31(4,5)19-12-15-27-18-17-26-3;1-2/h14H,1,9-13,15-21H2,2-8H3;1H2 |
| InChIKey | SOOZZPSSWBKVFC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.91 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|