C22H56O8Si7 — CID 18739209
3-[bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 18739209) has the molecular formula C22H56O8Si7 and a molecular weight of 645.28 g/mol. Its IUPAC name is 3-[bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 18739209 |
| Molecular Formula | C22H56O8Si7 |
| Molecular Weight | 645.28 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | 3-[bis[[[dimethyl(trimethylsilyloxy)silyl]oxy-dimethylsilyl]oxy]-methylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H56O8Si7/c1-21(2)22(23)24-19-18-20-37(17,29-35(13,14)27-33(9,10)25-31(3,4)5)30-36(15,16)28-34(11,12)26-32(6,7)8/h1,18-20H2,2-17H3 |
| InChIKey | NWMZBVGZFSQJJA-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.28 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|