C10H20O6Si — CID 141453327
3-[methyl-bis(methylperoxy)silyl]propyl 2-methylprop-2-enoate (PubChem CID 141453327) has the molecular formula C10H20O6Si and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-[methyl-bis(methylperoxy)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[methyl-bis(methylperoxy)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141453327 |
| Molecular Formula | C10H20O6Si |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 3-[methyl-bis(methylperoxy)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(OOC)OOC |
| InChI | InChI=1S/C10H20O6Si/c1-9(2)10(11)14-7-6-8-17(5,15-12-3)16-13-4/h1,6-8H2,2-5H3 |
| InChIKey | VQXVNGZZFRVNLY-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|