C17H34O6Si2 — CID 175909002
2-[hydroxy(dimethyl)silyl]ethyl 2-methylprop-2-enoate;3-[hydroxy(dimethyl)silyl]propyl 2-methylprop-2-enoate (PubChem CID 175909002) has the molecular formula C17H34O6Si2 and a molecular weight of 390.63 g/mol. Its IUPAC name is 2-[hydroxy(dimethyl)silyl]ethyl 2-methylprop-2-enoate;3-[hydroxy(dimethyl)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 2-[hydroxy(dimethyl)silyl]ethyl 2-methylprop-2-enoate;3-[hydroxy(dimethyl)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175909002 |
| Molecular Formula | C17H34O6Si2 |
| Molecular Weight | 390.63 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[hydroxy(dimethyl)silyl]ethyl 2-methylprop-2-enoate;3-[hydroxy(dimethyl)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O.C=C(C)C(=O)OCC[Si](C)(C)O |
| InChI | InChI=1S/C9H18O3Si.C8H16O3Si/c1-8(2)9(10)12-6-5-7-13(3,4)11;1-7(2)8(9)11-5-6-12(3,4)10/h11H,1,5-7H2,2-4H3;10H,1,5-6H2,2-4H3 |
| InChIKey | WSWZGTTXNFWNMG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.63 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|