C20H38O6Si2 — CID 156628189
3-[2-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxyethoxy-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 156628189) has the molecular formula C20H38O6Si2 and a molecular weight of 430.69 g/mol. Its IUPAC name is 3-[2-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxyethoxy-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[2-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxyethoxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156628189 |
| Molecular Formula | C20H38O6Si2 |
| Molecular Weight | 430.69 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 3-[2-[dimethyl-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxyethoxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)OCCO[Si](C)(C)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C20H38O6Si2/c1-17(2)19(21)23-11-9-15-27(5,6)25-13-14-26-28(7,8)16-10-12-24-20(22)18(3)4/h1,3,9-16H2,2,4-8H3 |
| InChIKey | XMSRRYXEHBLTJL-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|