C20H48O3Si4 — CID 157121683
3-[[dimethyl(2-trimethylsilylethyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate;tetramethylsilane (PubChem CID 157121683) has the molecular formula C20H48O3Si4 and a molecular weight of 448.95 g/mol. Its IUPAC name is 3-[[dimethyl(2-trimethylsilylethyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate;tetramethylsilane.
| Compound Name | 3-[[dimethyl(2-trimethylsilylethyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate;tetramethylsilane |
|---|---|
| PubChem CID | 157121683 |
| Molecular Formula | C20H48O3Si4 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 3-[[dimethyl(2-trimethylsilylethyl)silyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate;tetramethylsilane |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)CC[Si](C)(C)C.C[Si](C)(C)C |
| InChI | InChI=1S/C16H36O3Si3.C4H12Si/c1-15(2)16(17)18-11-10-12-21(6,7)19-22(8,9)14-13-20(3,4)5;1-5(2,3)4/h1,10-14H2,2-9H3;1-4H3 |
| InChIKey | AIAUIJPLOOLWQD-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|