C18H40O4Si4 — CID 140713622
3-[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate (PubChem CID 140713622) has the molecular formula C18H40O4Si4 and a molecular weight of 432.86 g/mol. Its IUPAC name is 3-[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140713622 |
| Molecular Formula | C18H40O4Si4 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 3-[[[[ethenyl(dimethyl)silyl]oxy-dimethylsilyl]methyl-dimethylsilyl]oxy-dimethylsilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C[Si](C)(C)O[Si](C)(C)C[Si](C)(C)O[Si](C)(C)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C18H40O4Si4/c1-12-23(4,5)21-25(8,9)16-26(10,11)22-24(6,7)15-13-14-20-18(19)17(2)3/h12H,1-2,13-16H2,3-11H3 |
| InChIKey | GHYOTHUYFXBCCF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|