C15H30O5Si3 — CID 22325845
3-[bis[[ethenyl(dimethyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 22325845) has the molecular formula C15H30O5Si3 and a molecular weight of 374.66 g/mol. Its IUPAC name is 3-[bis[[ethenyl(dimethyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[bis[[ethenyl(dimethyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22325845 |
| Molecular Formula | C15H30O5Si3 |
| Molecular Weight | 374.66 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-[bis[[ethenyl(dimethyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C[Si](C)(C)O[Si](O)(CCCOC(=O)C(=C)C)O[Si](C)(C)C=C |
| InChI | InChI=1S/C15H30O5Si3/c1-9-21(5,6)19-23(17,20-22(7,8)10-2)13-11-12-18-15(16)14(3)4/h9-10,17H,1-3,11-13H2,4-8H3 |
| InChIKey | YHBXUCNHUKXBLZ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.66 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|