C23H34O5Si3 — CID 66674902
3-[bis[[dimethyl(phenyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 66674902) has the molecular formula C23H34O5Si3 and a molecular weight of 474.78 g/mol. Its IUPAC name is 3-[bis[[dimethyl(phenyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[bis[[dimethyl(phenyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66674902 |
| Molecular Formula | C23H34O5Si3 |
| Molecular Weight | 474.78 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 3-[bis[[dimethyl(phenyl)silyl]oxy]-hydroxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](O)(O[Si](C)(C)c1ccccc1)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H34O5Si3/c1-20(2)23(24)26-18-13-19-31(25,27-29(3,4)21-14-9-7-10-15-21)28-30(5,6)22-16-11-8-12-17-22/h7-12,14-17,25H,1,13,18-19H2,2-6H3 |
| InChIKey | YBHLEQMPRVDELJ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.78 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|