C21H28O6Si2 — CID 102349948
3-[hydroxy-methoxy-[methoxy(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 102349948) has the molecular formula C21H28O6Si2 and a molecular weight of 432.62 g/mol. Its IUPAC name is 3-[hydroxy-methoxy-[methoxy(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[hydroxy-methoxy-[methoxy(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102349948 |
| Molecular Formula | C21H28O6Si2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 3-[hydroxy-methoxy-[methoxy(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](O)(OC)O[Si](OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28O6Si2/c1-18(2)21(22)26-16-11-17-28(23,24-3)27-29(25-4,19-12-7-5-8-13-19)20-14-9-6-10-15-20/h5-10,12-15,23H,1,11,16-17H2,2-4H3 |
| InChIKey | VMIJBTQRZHCYHX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|