C19H36O13Si4 — CID 176804843
3-[[[[hydroperoxy(dimethoxy)silyl]oxy-methoxy-phenylsilyl]oxy-methoxy-methylsilyl]oxy-hydroxy-methoxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 176804843) has the molecular formula C19H36O13Si4 and a molecular weight of 584.83 g/mol. Its IUPAC name is 3-[[[[hydroperoxy(dimethoxy)silyl]oxy-methoxy-phenylsilyl]oxy-methoxy-methylsilyl]oxy-hydroxy-methoxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[[[[hydroperoxy(dimethoxy)silyl]oxy-methoxy-phenylsilyl]oxy-methoxy-methylsilyl]oxy-hydroxy-methoxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 176804843 |
| Molecular Formula | C19H36O13Si4 |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.12 |
| IUPAC Name | 3-[[[[hydroperoxy(dimethoxy)silyl]oxy-methoxy-phenylsilyl]oxy-methoxy-methylsilyl]oxy-hydroxy-methoxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](O)(OC)O[Si](C)(OC)O[Si](OC)(O[Si](OC)(OC)OO)c1ccccc1 |
| InChI | InChI=1S/C19H36O13Si4/c1-17(2)19(20)28-15-12-16-34(22,24-4)30-33(8,23-3)31-35(25-5,18-13-10-9-11-14-18)32-36(26-6,27-7)29-21/h9-11,13-14,21-22H,1,12,15-16H2,2-8H3 |
| InChIKey | RNUPEVZROZGPQQ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 149.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|