C20H30O5Si — CID 175495096
1,2-bis(ethenyl)benzene;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 175495096) has the molecular formula C20H30O5Si and a molecular weight of 378.54 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | 1,2-bis(ethenyl)benzene;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175495096 |
| Molecular Formula | C20H30O5Si |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC)(OC)OC.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H20O5Si.C10H10/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-3-9-7-5-6-8-10(9)4-2/h1,6-8H2,2-5H3;3-8H,1-2H2 |
| InChIKey | KNIUUMIOSUBWDT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|