C22H32O2 — CID 21392908
1,2-bis(ethenyl)benzene;octyl 2-methylprop-2-enoate (PubChem CID 21392908) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;octyl 2-methylprop-2-enoate.
| Compound Name | 1,2-bis(ethenyl)benzene;octyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 21392908 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;octyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCC.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C12H22O2.C10H10/c1-4-5-6-7-8-9-10-14-12(13)11(2)3;1-3-9-7-5-6-8-10(9)4-2/h2,4-10H2,1,3H3;3-8H,1-2H2 |
| InChIKey | UQZVDAQHTJGDBK-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|