C25H39ClO2 — CID 166691897
1-chloroprop-2-enylbenzene;dodecyl 2-methylprop-2-enoate (PubChem CID 166691897) has the molecular formula C25H39ClO2 and a molecular weight of 407.04 g/mol. Its IUPAC name is 1-chloroprop-2-enylbenzene;dodecyl 2-methylprop-2-enoate.
| Compound Name | 1-chloroprop-2-enylbenzene;dodecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 166691897 |
| Molecular Formula | C25H39ClO2 |
| Molecular Weight | 407.04 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 1-chloroprop-2-enylbenzene;dodecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCC.C=CC(Cl)c1ccccc1 |
| InChI | InChI=1S/C16H30O2.C9H9Cl/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;1-2-9(10)8-6-4-3-5-7-8/h2,4-14H2,1,3H3;2-7,9H,1H2 |
| InChIKey | BGXLHNQWWKFKMF-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.04 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|