C26H40O4 — CID 174889777
dodecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid (PubChem CID 174889777) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is dodecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid.
| Compound Name | dodecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid |
|---|---|
| PubChem CID | 174889777 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | dodecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCC.O=C(O)CC=Cc1ccccc1 |
| InChI | InChI=1S/C16H30O2.C10H10O2/c1-4-5-6-7-8-9-10-11-12-13-14-18-16(17)15(2)3;11-10(12)8-4-7-9-5-2-1-3-6-9/h2,4-14H2,1,3H3;1-7H,8H2,(H,11,12) |
| InChIKey | FBQPSZYRZRIUGA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|