C32H52O4 — CID 174890269
octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid (PubChem CID 174890269) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid.
| Compound Name | octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid |
|---|---|
| PubChem CID | 174890269 |
| Molecular Formula | C32H52O4 |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.39 |
| IUPAC Name | octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.O=C(O)CC=Cc1ccccc1 |
| InChI | InChI=1S/C22H42O2.C10H10O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;11-10(12)8-4-7-9-5-2-1-3-6-9/h2,4-20H2,1,3H3;1-7H,8H2,(H,11,12) |
| InChIKey | MFNAALGHVXTPJW-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|