octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid

C32H52O4 — CID 174890269

IUPACoctadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid
SMILESC=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.O=C(O)CC=Cc1ccccc1
InChIInChI=1S/C22H42O2.C10H10O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;11-10(12)8-4-7-9-5-2-1-3-6-9/h2,4-20H2,1,3H3;1-7H,8H2,(H,11,12)
InChIKeyMFNAALGHVXTPJW-UHFFFAOYSA-N
MW500.76 g/mol
LogP9.54
Rot. Bonds21

About octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid

octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid (PubChem CID 174890269) has the molecular formula C32H52O4 and a molecular weight of 500.76 g/mol. Its IUPAC name is octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid.

Molecular Properties

Compound Nameoctadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid
PubChem CID174890269
Molecular FormulaC32H52O4
Molecular Weight500.76 g/mol
Exact Mass500.39
IUPAC Nameoctadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid
SMILESC=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.O=C(O)CC=Cc1ccccc1
InChIInChI=1S/C22H42O2.C10H10O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;11-10(12)8-4-7-9-5-2-1-3-6-9/h2,4-20H2,1,3H3;1-7H,8H2,(H,11,12)
InChIKeyMFNAALGHVXTPJW-UHFFFAOYSA-N
XLogP9.54
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds21
Heavy Atoms36
Complexity

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500500.76
LogP ≤ 59.54
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid?
The IUPAC name of octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid (CID 174890269) is octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid.
What is the SMILES notation for octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid?
The canonical SMILES for octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid is C=C(C)C(=O)OCCCCCCCCCCCCCCCCCC.O=C(O)CC=Cc1ccccc1.
What is the InChIKey of octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid?
The InChIKey is MFNAALGHVXTPJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2.C10H10O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-24-22(23)21(2)3;11-10(12)8-4-7-9-5-2-1-3-6-9/h2,4-20H2,1,3H3;1-7H,8H2,(H,11,12).
What are the key properties of octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid?
octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid has a molecular weight of 500.76 g/mol, XLogP of 9.54, 21 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadecyl 2-methylprop-2-enoate;4-phenylbut-3-enoic acid is sourced from PubChem (CID 174890269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).