C31H44O7 — CID 87766071
hexyl 2-methylidenebutanoate;methyl 2-methylidene-5-phenylpent-4-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87766071) has the molecular formula C31H44O7 and a molecular weight of 528.69 g/mol. Its IUPAC name is hexyl 2-methylidenebutanoate;methyl 2-methylidene-5-phenylpent-4-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | hexyl 2-methylidenebutanoate;methyl 2-methylidene-5-phenylpent-4-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87766071 |
| Molecular Formula | C31H44O7 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.31 |
| IUPAC Name | hexyl 2-methylidenebutanoate;methyl 2-methylidene-5-phenylpent-4-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C(CC)C(=O)OCCCCCC.C=C(CC=Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C13H14O2.C11H20O2.C7H10O3/c1-11(13(14)15-2)7-6-10-12-8-4-3-5-9-12;1-4-6-7-8-9-13-11(12)10(3)5-2;1-5(2)7(8)10-4-6-3-9-6/h3-6,8-10H,1,7H2,2H3;3-9H2,1-2H3;6H,1,3-4H2,2H3 |
| InChIKey | GABFAYYDFBVEPC-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|