C25H28O3 — CID 174763598
buta-1,3-dienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;styrene (PubChem CID 174763598) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is buta-1,3-dienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;styrene.
| Compound Name | buta-1,3-dienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 174763598 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | buta-1,3-dienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC=Cc1ccccc1.C=Cc1ccccc1 |
| InChI | InChI=1S/C10H10.C8H8.C7H10O3/c1-2-3-7-10-8-5-4-6-9-10;1-2-8-6-4-3-5-7-8;1-5(2)7(8)10-4-6-3-9-6/h2-9H,1H2;2-7H,1H2;6H,1,3-4H2,2H3 |
| InChIKey | GKTRDFQHPPPDEI-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|