C19H22O3 — CID 87932793
hexa-1,3,5-trienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87932793) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is hexa-1,3,5-trienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | hexa-1,3,5-trienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87932793 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | hexa-1,3,5-trienylbenzene;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC=CC=Cc1ccccc1 |
| InChI | InChI=1S/C12H12.C7H10O3/c1-2-3-4-6-9-12-10-7-5-8-11-12;1-5(2)7(8)10-4-6-3-9-6/h2-11H,1H2;6H,1,3-4H2,2H3 |
| InChIKey | XUUXHNIFCUYEHR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|