C14H19NO3 — CID 175327746
oxiran-2-ylmethyl 2-methylprop-2-enoate;phenylmethanamine (PubChem CID 175327746) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;phenylmethanamine.
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;phenylmethanamine |
|---|---|
| PubChem CID | 175327746 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;phenylmethanamine |
| SMILES | C=C(C)C(=O)OCC1CO1.NCc1ccccc1 |
| InChI | InChI=1S/C7H9N.C7H10O3/c8-6-7-4-2-1-3-5-7;1-5(2)7(8)10-4-6-3-9-6/h1-5H,6,8H2;6H,1,3-4H2,2H3 |
| InChIKey | HBYGTQMEXDGQEI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|