C19H28O7 — CID 87727049
4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87727049) has the molecular formula C19H28O7 and a molecular weight of 368.43 g/mol. Its IUPAC name is 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87727049 |
| Molecular Formula | C19H28O7 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-(2-methylprop-2-enoyloxy)butyl 2-methylprop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C(C)C(=O)OCCCCOC(=O)C(=C)C |
| InChI | InChI=1S/C12H18O4.C7H10O3/c1-9(2)11(13)15-7-5-6-8-16-12(14)10(3)4;1-5(2)7(8)10-4-6-3-9-6/h1,3,5-8H2,2,4H3;6H,1,3-4H2,2H3 |
| InChIKey | VDOYIHNSWRRSFW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|