C11H19O9P — CID 175461208
2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate;phosphoric acid (PubChem CID 175461208) has the molecular formula C11H19O9P and a molecular weight of 326.24 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate;phosphoric acid.
| Compound Name | 2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate;phosphoric acid |
|---|---|
| PubChem CID | 175461208 |
| Molecular Formula | C11H19O9P |
| Molecular Weight | 326.24 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | 2-methylprop-2-enoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate;phosphoric acid |
| SMILES | C=C(C)C(=O)O.C=C(C)C(=O)OCC1CO1.O=P(O)(O)O |
| InChI | InChI=1S/C7H10O3.C4H6O2.H3O4P/c1-5(2)7(8)10-4-6-3-9-6;1-3(2)4(5)6;1-5(2,3)4/h6H,1,3-4H2,2H3;1H2,2H3,(H,5,6);(H3,1,2,3,4) |
| InChIKey | DSNBEUJEKGYIRY-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 153.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.24 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|