About methane;oxiran-2-ylmethyl 2-methylprop-2-enoate
methane;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87151920) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is methane;oxiran-2-ylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | methane;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| PubChem CID | 87151920 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | methane;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C.C=C(C)C(=O)OCC1CO1 |
| InChI | InChI=1S/C7H10O3.CH4/c1-5(2)7(8)10-4-6-3-9-6;/h6H,1,3-4H2,2H3;1H4 |
| InChIKey | SRENDDYHBOWWHJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze methane;oxiran-2-ylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The IUPAC name of methane;oxiran-2-ylmethyl 2-methylprop-2-enoate (CID 87151920) is methane;oxiran-2-ylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The canonical SMILES for methane;oxiran-2-ylmethyl 2-methylprop-2-enoate is C.C=C(C)C(=O)OCC1CO1.
What is the InChIKey of methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The InChIKey is SRENDDYHBOWWHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.CH4/c1-5(2)7(8)10-4-6-3-9-6;/h6H,1,3-4H2,2H3;1H4.
What are the key properties of methane;oxiran-2-ylmethyl 2-methylprop-2-enoate?
methane;oxiran-2-ylmethyl 2-methylprop-2-enoate has a molecular weight of 158.20 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;oxiran-2-ylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 87151920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).