C13H20O5 — CID 175778855
but-3-enoic acid;ethene;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 175778855) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is but-3-enoic acid;ethene;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | but-3-enoic acid;ethene;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175778855 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | but-3-enoic acid;ethene;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C.C=C(C)C(=O)OCC1CO1.C=CCC(=O)O |
| InChI | InChI=1S/C7H10O3.C4H6O2.C2H4/c1-5(2)7(8)10-4-6-3-9-6;1-2-3-4(5)6;1-2/h6H,1,3-4H2,2H3;2H,1,3H2,(H,5,6);1-2H2 |
| InChIKey | COKFFMZPJNWMJX-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|