About oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane
oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane (PubChem CID 174970981) has the molecular formula C7H12O4Si
and a molecular weight of 188.25 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane.
Molecular Properties
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane |
| PubChem CID | 174970981 |
| Molecular Formula | C7H12O4Si |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane |
| SMILES | C=C(C)C(=O)OCC1CO1.O=[SiH2] |
| InChI | InChI=1S/C7H10O3.H2OSi/c1-5(2)7(8)10-4-6-3-9-6;1-2/h6H,1,3-4H2,2H3;2H2 |
| InChIKey | KNIPYLZAIMMTCA-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane?
The IUPAC name of oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane (CID 174970981) is oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane.
What is the SMILES notation for oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane?
The canonical SMILES for oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane is C=C(C)C(=O)OCC1CO1.O=[SiH2].
What is the InChIKey of oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane?
The InChIKey is KNIPYLZAIMMTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3.H2OSi/c1-5(2)7(8)10-4-6-3-9-6;1-2/h6H,1,3-4H2,2H3;2H2.
What are the key properties of oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane?
oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane has a molecular weight of 188.25 g/mol, XLogP of -0.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for oxiran-2-ylmethyl 2-methylprop-2-enoate;oxosilane is sourced from PubChem (CID 174970981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).