C14H22O5 — CID 87254151
2-methylidenehexanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87254151) has the molecular formula C14H22O5 and a molecular weight of 270.32 g/mol. Its IUPAC name is 2-methylidenehexanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | 2-methylidenehexanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87254151 |
| Molecular Formula | C14H22O5 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-methylidenehexanoic acid;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C(CCCC)C(=O)O |
| InChI | InChI=1S/C7H10O3.C7H12O2/c1-5(2)7(8)10-4-6-3-9-6;1-3-4-5-6(2)7(8)9/h6H,1,3-4H2,2H3;2-5H2,1H3,(H,8,9) |
| InChIKey | AZFUIZMUSJCVCV-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|