C22H36O7 — CID 6454134
butyl 2-methylprop-2-enoate;butyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 6454134) has the molecular formula C22H36O7 and a molecular weight of 412.52 g/mol. Its IUPAC name is butyl 2-methylprop-2-enoate;butyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
| Compound Name | butyl 2-methylprop-2-enoate;butyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 6454134 |
| Molecular Formula | C22H36O7 |
| Molecular Weight | 412.52 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | butyl 2-methylprop-2-enoate;butyl prop-2-enoate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C(C)C(=O)OCCCC.C=CC(=O)OCCCC |
| InChI | InChI=1S/C8H14O2.C7H10O3.C7H12O2/c1-4-5-6-10-8(9)7(2)3;1-5(2)7(8)10-4-6-3-9-6;1-3-5-6-9-7(8)4-2/h2,4-6H2,1,3H3;6H,1,3-4H2,2H3;4H,2-3,5-6H2,1H3 |
| InChIKey | OPWFQEZIDYTPCT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|