C18H29NO7 — CID 174830749
N-butoxy-N-methylprop-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 174830749) has the molecular formula C18H29NO7 and a molecular weight of 371.43 g/mol. Its IUPAC name is N-butoxy-N-methylprop-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | N-butoxy-N-methylprop-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174830749 |
| Molecular Formula | C18H29NO7 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-butoxy-N-methylprop-2-enamide;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC(=O)N(C)OCCCC.C=CC(=O)O |
| InChI | InChI=1S/C8H15NO2.C7H10O3.C3H4O2/c1-4-6-7-11-9(3)8(10)5-2;1-5(2)7(8)10-4-6-3-9-6;1-2-3(4)5/h5H,2,4,6-7H2,1,3H3;6H,1,3-4H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | NYWGVJOGPLEOOO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|