C17H30O9 — CID 174476638
2-(hydroxymethyl)-2-(1-methoxyethyl)propane-1,3-diol;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid (PubChem CID 174476638) has the molecular formula C17H30O9 and a molecular weight of 378.42 g/mol. Its IUPAC name is 2-(hydroxymethyl)-2-(1-methoxyethyl)propane-1,3-diol;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid.
| Compound Name | 2-(hydroxymethyl)-2-(1-methoxyethyl)propane-1,3-diol;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid |
|---|---|
| PubChem CID | 174476638 |
| Molecular Formula | C17H30O9 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 2-(hydroxymethyl)-2-(1-methoxyethyl)propane-1,3-diol;oxiran-2-ylmethyl 2-methylprop-2-enoate;prop-2-enoic acid |
| SMILES | C=C(C)C(=O)OCC1CO1.C=CC(=O)O.COC(C)C(CO)(CO)CO |
| InChI | InChI=1S/C7H16O4.C7H10O3.C3H4O2/c1-6(11-2)7(3-8,4-9)5-10;1-5(2)7(8)10-4-6-3-9-6;1-2-3(4)5/h6,8-10H,3-5H2,1-2H3;6H,1,3-4H2,2H3;2H,1H2,(H,4,5) |
| InChIKey | VFTLSLSKCGNXAC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 146.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|