C19H18O6 — CID 86748319
oxiran-2-ylmethyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione (PubChem CID 86748319) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is oxiran-2-ylmethyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione.
| Compound Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione |
|---|---|
| PubChem CID | 86748319 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | oxiran-2-ylmethyl 2-methylprop-2-enoate;3-(2-phenylethenyl)furan-2,5-dione |
| SMILES | C=C(C)C(=O)OCC1CO1.O=C1C=C(C=Cc2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C12H8O3.C7H10O3/c13-11-8-10(12(14)15-11)7-6-9-4-2-1-3-5-9;1-5(2)7(8)10-4-6-3-9-6/h1-8H;6H,1,3-4H2,2H3 |
| InChIKey | SXBYDJKJRJINEF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 82.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|