C20H24O3 — CID 174901065
1,2-bis(ethenyl)benzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;propa-1,2-diene (PubChem CID 174901065) has the molecular formula C20H24O3 and a molecular weight of 312.41 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;propa-1,2-diene.
| Compound Name | 1,2-bis(ethenyl)benzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;propa-1,2-diene |
|---|---|
| PubChem CID | 174901065 |
| Molecular Formula | C20H24O3 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;oxiran-2-ylmethyl 2-methylprop-2-enoate;propa-1,2-diene |
| SMILES | C=C(C)C(=O)OCC1CO1.C=C=C.C=Cc1ccccc1C=C |
| InChI | InChI=1S/C10H10.C7H10O3.C3H4/c1-3-9-7-5-6-8-10(9)4-2;1-5(2)7(8)10-4-6-3-9-6;1-3-2/h3-8H,1-2H2;6H,1,3-4H2,2H3;1-2H2 |
| InChIKey | TXZQNXCHSPYSQZ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|