C18H22O4 — CID 66766714
methyl 2-methylidene-5-phenylpent-4-enoate;methyl 2-methylprop-2-enoate (PubChem CID 66766714) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is methyl 2-methylidene-5-phenylpent-4-enoate;methyl 2-methylprop-2-enoate.
| Compound Name | methyl 2-methylidene-5-phenylpent-4-enoate;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66766714 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | methyl 2-methylidene-5-phenylpent-4-enoate;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(CC=Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C13H14O2.C5H8O2/c1-11(13(14)15-2)7-6-10-12-8-4-3-5-9-12;1-4(2)5(6)7-3/h3-6,8-10H,1,7H2,2H3;1H2,2-3H3 |
| InChIKey | FXYQXMJJRZBHCN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|