C25H26O2 — CID 88501534
methyl 2-methylprop-2-enoate;3-(2-phenylethenyl)hexa-1,3,5-trienylbenzene (PubChem CID 88501534) has the molecular formula C25H26O2 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl 2-methylprop-2-enoate;3-(2-phenylethenyl)hexa-1,3,5-trienylbenzene.
| Compound Name | methyl 2-methylprop-2-enoate;3-(2-phenylethenyl)hexa-1,3,5-trienylbenzene |
|---|---|
| PubChem CID | 88501534 |
| Molecular Formula | C25H26O2 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | methyl 2-methylprop-2-enoate;3-(2-phenylethenyl)hexa-1,3,5-trienylbenzene |
| SMILES | C=C(C)C(=O)OC.C=CC=C(C=Cc1ccccc1)C=Cc1ccccc1 |
| InChI | InChI=1S/C20H18.C5H8O2/c1-2-9-18(14-16-19-10-5-3-6-11-19)15-17-20-12-7-4-8-13-20;1-4(2)5(6)7-3/h2-17H,1H2;1H2,2-3H3 |
| InChIKey | TWKNMXPVIXMBJJ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|