C17H20O6 — CID 70445514
(Z)-but-2-enedioic acid;methyl 2-methylprop-2-enoate;styrene (PubChem CID 70445514) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;methyl 2-methylprop-2-enoate;styrene.
| Compound Name | (Z)-but-2-enedioic acid;methyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 70445514 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | (Z)-but-2-enedioic acid;methyl 2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)OC.C=Cc1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C8H8.C5H8O2.C4H4O4/c1-2-8-6-4-3-5-7-8;1-4(2)5(6)7-3;5-3(6)1-2-4(7)8/h2-7H,1H2;1H2,2-3H3;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | CQRIXJWODRZWIO-KSBRXOFISA-N |
| XLogP | 2.78 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|