C18H25NO3 — CID 23364974
(E)-2-methylbut-2-enamide;methyl 2-methylprop-2-enoate;styrene (PubChem CID 23364974) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (E)-2-methylbut-2-enamide;methyl 2-methylprop-2-enoate;styrene.
| Compound Name | (E)-2-methylbut-2-enamide;methyl 2-methylprop-2-enoate;styrene |
|---|---|
| PubChem CID | 23364974 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (E)-2-methylbut-2-enamide;methyl 2-methylprop-2-enoate;styrene |
| SMILES | C/C=C(\C)C(N)=O.C=C(C)C(=O)OC.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C5H9NO.C5H8O2/c1-2-8-6-4-3-5-7-8;1-3-4(2)5(6)7;1-4(2)5(6)7-3/h2-7H,1H2;3H,1-2H3,(H2,6,7);1H2,2-3H3/b;4-3+; |
| InChIKey | ROOOEYDEYCOMDB-ITDJAWRYSA-N |
| XLogP | 3.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|