About ethane;2-methylprop-2-enoic acid;styrene
ethane;2-methylprop-2-enoic acid;styrene (PubChem CID 174478215) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is ethane;2-methylprop-2-enoic acid;styrene.
Molecular Properties
| Compound Name | ethane;2-methylprop-2-enoic acid;styrene |
| PubChem CID | 174478215 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | ethane;2-methylprop-2-enoic acid;styrene |
| SMILES | C=C(C)C(=O)O.C=Cc1ccccc1.CC |
| InChI | InChI=1S/C8H8.C4H6O2.C2H6/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6;1-2/h2-7H,1H2;1H2,2H3,(H,5,6);1-2H3 |
| InChIKey | KIOPLEIECFCDRM-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methylprop-2-enoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methylprop-2-enoic acid;styrene?
The IUPAC name of ethane;2-methylprop-2-enoic acid;styrene (CID 174478215) is ethane;2-methylprop-2-enoic acid;styrene.
What is the SMILES notation for ethane;2-methylprop-2-enoic acid;styrene?
The canonical SMILES for ethane;2-methylprop-2-enoic acid;styrene is C=C(C)C(=O)O.C=Cc1ccccc1.CC.
What is the InChIKey of ethane;2-methylprop-2-enoic acid;styrene?
The InChIKey is KIOPLEIECFCDRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C4H6O2.C2H6/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6;1-2/h2-7H,1H2;1H2,2H3,(H,5,6);1-2H3.
What are the key properties of ethane;2-methylprop-2-enoic acid;styrene?
ethane;2-methylprop-2-enoic acid;styrene has a molecular weight of 220.31 g/mol, XLogP of 4.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methylprop-2-enoic acid;styrene is sourced from PubChem (CID 174478215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).