About chloroform;propan-2-one;styrene
chloroform;propan-2-one;styrene (PubChem CID 70453221) has the molecular formula C12H15Cl3O
and a molecular weight of 281.61 g/mol. Its IUPAC name is chloroform;propan-2-one;styrene.
Molecular Properties
| Compound Name | chloroform;propan-2-one;styrene |
| PubChem CID | 70453221 |
| Molecular Formula | C12H15Cl3O |
| Molecular Weight | 281.61 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | chloroform;propan-2-one;styrene |
| SMILES | C=Cc1ccccc1.CC(C)=O.ClC(Cl)Cl |
| InChI | InChI=1S/C8H8.C3H6O.CHCl3/c1-2-8-6-4-3-5-7-8;1-3(2)4;2-1(3)4/h2-7H,1H2;1-2H3;1H |
| InChIKey | BUABMAHCWOXYLK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloroform;propan-2-one;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;propan-2-one;styrene?
The IUPAC name of chloroform;propan-2-one;styrene (CID 70453221) is chloroform;propan-2-one;styrene.
What is the SMILES notation for chloroform;propan-2-one;styrene?
The canonical SMILES for chloroform;propan-2-one;styrene is C=Cc1ccccc1.CC(C)=O.ClC(Cl)Cl.
What is the InChIKey of chloroform;propan-2-one;styrene?
The InChIKey is BUABMAHCWOXYLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C3H6O.CHCl3/c1-2-8-6-4-3-5-7-8;1-3(2)4;2-1(3)4/h2-7H,1H2;1-2H3;1H.
What are the key properties of chloroform;propan-2-one;styrene?
chloroform;propan-2-one;styrene has a molecular weight of 281.61 g/mol, XLogP of 4.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;propan-2-one;styrene is sourced from PubChem (CID 70453221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).