About 2-hydroxyprop-2-enoic acid;styrene
2-hydroxyprop-2-enoic acid;styrene (PubChem CID 67611169) has the molecular formula C11H12O3
and a molecular weight of 192.21 g/mol. Its IUPAC name is 2-hydroxyprop-2-enoic acid;styrene.
Molecular Properties
| Compound Name | 2-hydroxyprop-2-enoic acid;styrene |
| PubChem CID | 67611169 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 2-hydroxyprop-2-enoic acid;styrene |
| SMILES | C=C(O)C(=O)O.C=Cc1ccccc1 |
| InChI | InChI=1S/C8H8.C3H4O3/c1-2-8-6-4-3-5-7-8;1-2(4)3(5)6/h2-7H,1H2;4H,1H2,(H,5,6) |
| InChIKey | MPWVNFGOHBQCGK-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxyprop-2-enoic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxyprop-2-enoic acid;styrene?
The IUPAC name of 2-hydroxyprop-2-enoic acid;styrene (CID 67611169) is 2-hydroxyprop-2-enoic acid;styrene.
What is the SMILES notation for 2-hydroxyprop-2-enoic acid;styrene?
The canonical SMILES for 2-hydroxyprop-2-enoic acid;styrene is C=C(O)C(=O)O.C=Cc1ccccc1.
What is the InChIKey of 2-hydroxyprop-2-enoic acid;styrene?
The InChIKey is MPWVNFGOHBQCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C3H4O3/c1-2-8-6-4-3-5-7-8;1-2(4)3(5)6/h2-7H,1H2;4H,1H2,(H,5,6).
What are the key properties of 2-hydroxyprop-2-enoic acid;styrene?
2-hydroxyprop-2-enoic acid;styrene has a molecular weight of 192.21 g/mol, XLogP of 2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxyprop-2-enoic acid;styrene is sourced from PubChem (CID 67611169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).