About (Z)-but-2-enedioic acid;styrene
(Z)-but-2-enedioic acid;styrene (PubChem CID 67731875) has the molecular formula C20H20O4
and a molecular weight of 324.38 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;styrene.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;styrene |
| PubChem CID | 67731875 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (Z)-but-2-enedioic acid;styrene |
| SMILES | C=Cc1ccccc1.C=Cc1ccccc1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/2C8H8.C4H4O4/c2*1-2-8-6-4-3-5-7-8;5-3(6)1-2-4(7)8/h2*2-7H,1H2;1-2H,(H,5,6)(H,7,8)/b;;2-1- |
| InChIKey | JJROTBCFPICVLI-KSBRXOFISA-N |
| XLogP | 4.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;styrene?
The IUPAC name of (Z)-but-2-enedioic acid;styrene (CID 67731875) is (Z)-but-2-enedioic acid;styrene.
What is the SMILES notation for (Z)-but-2-enedioic acid;styrene?
The canonical SMILES for (Z)-but-2-enedioic acid;styrene is C=Cc1ccccc1.C=Cc1ccccc1.O=C(O)/C=C\C(=O)O.
What is the InChIKey of (Z)-but-2-enedioic acid;styrene?
The InChIKey is JJROTBCFPICVLI-KSBRXOFISA-N. The full InChI is InChI=1S/2C8H8.C4H4O4/c2*1-2-8-6-4-3-5-7-8;5-3(6)1-2-4(7)8/h2*2-7H,1H2;1-2H,(H,5,6)(H,7,8)/b;;2-1-.
What are the key properties of (Z)-but-2-enedioic acid;styrene?
(Z)-but-2-enedioic acid;styrene has a molecular weight of 324.38 g/mol, XLogP of 4.37, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;styrene is sourced from PubChem (CID 67731875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).